C21H21N3O — CID 113011554
4-methyl-N-[6-[(2-methylphenyl)methylamino]-3-pyridinyl]benzamide (PubChem CID 113011554) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-methyl-N-[6-[(2-methylphenyl)methylamino]-3-pyridinyl]benzamide.
| Compound Name | 4-methyl-N-[6-[(2-methylphenyl)methylamino]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113011554 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 4-methyl-N-[6-[(2-methylphenyl)methylamino]-3-pyridinyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(NCc3ccccc3C)nc2)cc1 |
| InChI | InChI=1S/C21H21N3O/c1-15-7-9-17(10-8-15)21(25)24-19-11-12-20(23-14-19)22-13-18-6-4-3-5-16(18)2/h3-12,14H,13H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | NTQHTERRTMERBF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |