C18H23N3O2 — CID 113012011
tert-butyl N-[6-[benzyl(methyl)amino]-3-pyridinyl]carbamate (PubChem CID 113012011) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl N-[6-[benzyl(methyl)amino]-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[benzyl(methyl)amino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113012011 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | tert-butyl N-[6-[benzyl(methyl)amino]-3-pyridinyl]carbamate |
| SMILES | CN(Cc1ccccc1)c1ccc(NC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C18H23N3O2/c1-18(2,3)23-17(22)20-15-10-11-16(19-12-15)21(4)13-14-8-6-5-7-9-14/h5-12H,13H2,1-4H3,(H,20,22) |
| InChIKey | YFPOCJMDYPOUOA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |