C23H20N4O3S — CID 1130123
N'-[11-(4-methoxyphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]benzohydrazide (PubChem CID 1130123) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is N'-[11-(4-methoxyphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]benzohydrazide.
| Compound Name | N'-[11-(4-methoxyphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]benzohydrazide |
|---|---|
| PubChem CID | 1130123 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N'-[11-(4-methoxyphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]benzohydrazide |
| SMILES | COc1ccc(-n2c(NNC(=O)c3ccccc3)nc3sc4c(c3c2=O)CCC4)cc1 |
| InChI | InChI=1S/C23H20N4O3S/c1-30-16-12-10-15(11-13-16)27-22(29)19-17-8-5-9-18(17)31-21(19)24-23(27)26-25-20(28)14-6-3-2-4-7-14/h2-4,6-7,10-13H,5,8-9H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | VKSJQOKPQJAKAE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|