C14H14ClN3O2 — CID 113012316
methyl N-[6-[(4-chlorophenyl)methylamino]-3-pyridinyl]carbamate (PubChem CID 113012316) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is methyl N-[6-[(4-chlorophenyl)methylamino]-3-pyridinyl]carbamate.
| Compound Name | methyl N-[6-[(4-chlorophenyl)methylamino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113012316 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | methyl N-[6-[(4-chlorophenyl)methylamino]-3-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NCc2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C14H14ClN3O2/c1-20-14(19)18-12-6-7-13(17-9-12)16-8-10-2-4-11(15)5-3-10/h2-7,9H,8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | YAAICADJTVFHOD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |