C21H24N4O2S — CID 113012992
4-tert-butyl-N-[6-(pyridin-4-ylmethylamino)-3-pyridinyl]benzenesulfonamide (PubChem CID 113012992) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[6-(pyridin-4-ylmethylamino)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[6-(pyridin-4-ylmethylamino)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113012992 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-tert-butyl-N-[6-(pyridin-4-ylmethylamino)-3-pyridinyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(NCc3ccncc3)nc2)cc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-21(2,3)17-4-7-19(8-5-17)28(26,27)25-18-6-9-20(24-15-18)23-14-16-10-12-22-13-11-16/h4-13,15,25H,14H2,1-3H3,(H,23,24) |
| InChIKey | VMPQDSKJGKOENW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |