C18H21FN4O2 — CID 113014423
ethyl N-[6-[4-(2-fluorophenyl)piperazin-1-yl]-3-pyridinyl]carbamate (PubChem CID 113014423) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is ethyl N-[6-[4-(2-fluorophenyl)piperazin-1-yl]-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-[4-(2-fluorophenyl)piperazin-1-yl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113014423 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | ethyl N-[6-[4-(2-fluorophenyl)piperazin-1-yl]-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(N2CCN(c3ccccc3F)CC2)nc1 |
| InChI | InChI=1S/C18H21FN4O2/c1-2-25-18(24)21-14-7-8-17(20-13-14)23-11-9-22(10-12-23)16-6-4-3-5-15(16)19/h3-8,13H,2,9-12H2,1H3,(H,21,24) |
| InChIKey | UXRQSEZTEXQFHG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |