C16H27N3O2S — CID 113015557
N-[6-(2-ethylpiperidin-1-yl)-3-pyridinyl]butane-1-sulfonamide (PubChem CID 113015557) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is N-[6-(2-ethylpiperidin-1-yl)-3-pyridinyl]butane-1-sulfonamide.
| Compound Name | N-[6-(2-ethylpiperidin-1-yl)-3-pyridinyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 113015557 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-[6-(2-ethylpiperidin-1-yl)-3-pyridinyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(N2CCCCC2CC)nc1 |
| InChI | InChI=1S/C16H27N3O2S/c1-3-5-12-22(20,21)18-14-9-10-16(17-13-14)19-11-7-6-8-15(19)4-2/h9-10,13,15,18H,3-8,11-12H2,1-2H3 |
| InChIKey | UIHPMPXXHUMVPS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |