C19H28O4 — CID 11301651
diethyl 2-but-3-ynyl-2-[(2Z)-cyclooct-2-en-1-yl]propanedioate (PubChem CID 11301651) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is diethyl 2-but-3-ynyl-2-[(2Z)-cyclooct-2-en-1-yl]propanedioate.
| Compound Name | diethyl 2-but-3-ynyl-2-[(2Z)-cyclooct-2-en-1-yl]propanedioate |
|---|---|
| PubChem CID | 11301651 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | diethyl 2-but-3-ynyl-2-[(2Z)-cyclooct-2-en-1-yl]propanedioate |
| SMILES | C#CCCC(C(=O)OCC)(C(=O)OCC)C1/C=C\CCCCC1 |
| InChI | InChI=1S/C19H28O4/c1-4-7-15-19(17(20)22-5-2,18(21)23-6-3)16-13-11-9-8-10-12-14-16/h1,11,13,16H,5-10,12,14-15H2,2-3H3/b13-11- |
| InChIKey | LYKOJPUOBJCRGR-QBFSEMIESA-N |
| XLogP | 3.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|