C20H19N3O4S — CID 113016930
N-[6-(2,5-dimethylanilino)-3-pyridinyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 113016930) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is N-[6-(2,5-dimethylanilino)-3-pyridinyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[6-(2,5-dimethylanilino)-3-pyridinyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 113016930 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-[6-(2,5-dimethylanilino)-3-pyridinyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | Cc1ccc(C)c(Nc2ccc(NS(=O)(=O)c3ccc4c(c3)OCO4)cn2)c1 |
| InChI | InChI=1S/C20H19N3O4S/c1-13-3-4-14(2)17(9-13)22-20-8-5-15(11-21-20)23-28(24,25)16-6-7-18-19(10-16)27-12-26-18/h3-11,23H,12H2,1-2H3,(H,21,22) |
| InChIKey | HGXQPDAYEGWDEV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |