C21H20FN3O — CID 113017295
N-[6-(2,3-dimethylanilino)-3-pyridinyl]-2-(2-fluorophenyl)acetamide (PubChem CID 113017295) has the molecular formula C21H20FN3O and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[6-(2,3-dimethylanilino)-3-pyridinyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[6-(2,3-dimethylanilino)-3-pyridinyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113017295 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-[6-(2,3-dimethylanilino)-3-pyridinyl]-2-(2-fluorophenyl)acetamide |
| SMILES | Cc1cccc(Nc2ccc(NC(=O)Cc3ccccc3F)cn2)c1C |
| InChI | InChI=1S/C21H20FN3O/c1-14-6-5-9-19(15(14)2)25-20-11-10-17(13-23-20)24-21(26)12-16-7-3-4-8-18(16)22/h3-11,13H,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | DQTSMZARJFNTEC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |