C24H27N3O — CID 113018155
N-[6-(4-tert-butylanilino)-3-pyridinyl]-2-(3-methylphenyl)acetamide (PubChem CID 113018155) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[6-(4-tert-butylanilino)-3-pyridinyl]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[6-(4-tert-butylanilino)-3-pyridinyl]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 113018155 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-[6-(4-tert-butylanilino)-3-pyridinyl]-2-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(CC(=O)Nc2ccc(Nc3ccc(C(C)(C)C)cc3)nc2)c1 |
| InChI | InChI=1S/C24H27N3O/c1-17-6-5-7-18(14-17)15-23(28)27-21-12-13-22(25-16-21)26-20-10-8-19(9-11-20)24(2,3)4/h5-14,16H,15H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | AHKFOEBTWJTBFZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |