C18H34O3Si — CID 11301846
2-[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-2-methylidenecyclohexyl]acetic acid (PubChem CID 11301846) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is 2-[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-2-methylidenecyclohexyl]acetic acid.
| Compound Name | 2-[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-2-methylidenecyclohexyl]acetic acid |
|---|---|
| PubChem CID | 11301846 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 2-[(1R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-2-methylidenecyclohexyl]acetic acid |
| SMILES | C=C1C(C)(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@]1(C)CC(=O)O |
| InChI | InChI=1S/C18H34O3Si/c1-13-17(5,6)11-10-14(18(13,7)12-15(19)20)21-22(8,9)16(2,3)4/h14H,1,10-12H2,2-9H3,(H,19,20)/t14-,18-/m1/s1 |
| InChIKey | BQPJIIDLSVIDDG-RDTXWAMCSA-N |
| XLogP | 5.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|