C19H18ClN3O2S — CID 113018483
N-[6-(2-chloroanilino)-3-pyridinyl]-2-phenylethanesulfonamide (PubChem CID 113018483) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.89 g/mol. Its IUPAC name is N-[6-(2-chloroanilino)-3-pyridinyl]-2-phenylethanesulfonamide.
| Compound Name | N-[6-(2-chloroanilino)-3-pyridinyl]-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 113018483 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-[6-(2-chloroanilino)-3-pyridinyl]-2-phenylethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1)Nc1ccc(Nc2ccccc2Cl)nc1 |
| InChI | InChI=1S/C19H18ClN3O2S/c20-17-8-4-5-9-18(17)22-19-11-10-16(14-21-19)23-26(24,25)13-12-15-6-2-1-3-7-15/h1-11,14,23H,12-13H2,(H,21,22) |
| InChIKey | NJTFQNHYGZMNER-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |