C16H18F3NO3 — CID 11301924
butyl (E)-3-[2-acetamido-5-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 11301924) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is butyl (E)-3-[2-acetamido-5-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | butyl (E)-3-[2-acetamido-5-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11301924 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | butyl (E)-3-[2-acetamido-5-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1cc(C(F)(F)F)ccc1NC(C)=O |
| InChI | InChI=1S/C16H18F3NO3/c1-3-4-9-23-15(22)8-5-12-10-13(16(17,18)19)6-7-14(12)20-11(2)21/h5-8,10H,3-4,9H2,1-2H3,(H,20,21)/b8-5+ |
| InChIKey | SZHZDVDYGDIIGA-VMPITWQZSA-N |
| XLogP | 4.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|