C20H26O2S — CID 11301967
(8R,9S,13S,14S)-2-ethylsulfanyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 11301967) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-ethylsulfanyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-2-ethylsulfanyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11301967 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (8R,9S,13S,14S)-2-ethylsulfanyl-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCSc1cc2c(cc1O)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H26O2S/c1-3-23-18-11-15-12(10-17(18)21)4-5-14-13(15)8-9-20(2)16(14)6-7-19(20)22/h10-11,13-14,16,21H,3-9H2,1-2H3/t13-,14+,16-,20-/m0/s1 |
| InChIKey | CCMAIFADJCJQDX-IDLUEMFASA-N |
| XLogP | 4.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |