C21H16F3N3O2 — CID 113020429
N-[6-(4-acetylanilino)-3-pyridinyl]-4-(trifluoromethyl)benzamide (PubChem CID 113020429) has the molecular formula C21H16F3N3O2 and a molecular weight of 399.37 g/mol. Its IUPAC name is N-[6-(4-acetylanilino)-3-pyridinyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[6-(4-acetylanilino)-3-pyridinyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 113020429 |
| Molecular Formula | C21H16F3N3O2 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[6-(4-acetylanilino)-3-pyridinyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(=O)c1ccc(Nc2ccc(NC(=O)c3ccc(C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C21H16F3N3O2/c1-13(28)14-4-8-17(9-5-14)26-19-11-10-18(12-25-19)27-20(29)15-2-6-16(7-3-15)21(22,23)24/h2-12H,1H3,(H,25,26)(H,27,29) |
| InChIKey | WBSJXNOTOGOBGS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |