About 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol
2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol (PubChem CID 11302263) has the molecular formula C16H18Cl2N2O2
and a molecular weight of 341.24 g/mol. Its IUPAC name is 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol |
| PubChem CID | 11302263 |
| Molecular Formula | C16H18Cl2N2O2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol |
| SMILES | CC(C)(CO)Nc1ccc(OCc2c(Cl)cccc2Cl)cn1 |
| InChI | InChI=1S/C16H18Cl2N2O2/c1-16(2,10-21)20-15-7-6-11(8-19-15)22-9-12-13(17)4-3-5-14(12)18/h3-8,21H,9-10H2,1-2H3,(H,19,20) |
| InChIKey | OTWYHKXYRABIHE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol?
The IUPAC name of 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol (CID 11302263) is 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol.
What is the SMILES notation for 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol?
The canonical SMILES for 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol is CC(C)(CO)Nc1ccc(OCc2c(Cl)cccc2Cl)cn1.
What is the InChIKey of 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol?
The InChIKey is OTWYHKXYRABIHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N2O2/c1-16(2,10-21)20-15-7-6-11(8-19-15)22-9-12-13(17)4-3-5-14(12)18/h3-8,21H,9-10H2,1-2H3,(H,19,20).
What are the key properties of 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol?
2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol has a molecular weight of 341.24 g/mol, XLogP of 4.15, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]amino]-2-methylpropan-1-ol is sourced from PubChem (CID 11302263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).