C19H12ClFN4O — CID 113022787
2-chloro-N-[6-(3-cyanoanilino)-3-pyridinyl]-6-fluorobenzamide (PubChem CID 113022787) has the molecular formula C19H12ClFN4O and a molecular weight of 366.78 g/mol. Its IUPAC name is 2-chloro-N-[6-(3-cyanoanilino)-3-pyridinyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[6-(3-cyanoanilino)-3-pyridinyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 113022787 |
| Molecular Formula | C19H12ClFN4O |
| Molecular Weight | 366.78 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2-chloro-N-[6-(3-cyanoanilino)-3-pyridinyl]-6-fluorobenzamide |
| SMILES | N#Cc1cccc(Nc2ccc(NC(=O)c3c(F)cccc3Cl)cn2)c1 |
| InChI | InChI=1S/C19H12ClFN4O/c20-15-5-2-6-16(21)18(15)19(26)25-14-7-8-17(23-11-14)24-13-4-1-3-12(9-13)10-22/h1-9,11H,(H,23,24)(H,25,26) |
| InChIKey | GHRQXKBHQRKFMN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |