C19H23N3O — CID 113024697
N-[5-(cyclohexylamino)-2-pyridinyl]-4-methylbenzamide (PubChem CID 113024697) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[5-(cyclohexylamino)-2-pyridinyl]-4-methylbenzamide.
| Compound Name | N-[5-(cyclohexylamino)-2-pyridinyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 113024697 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-[5-(cyclohexylamino)-2-pyridinyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(NC3CCCCC3)cn2)cc1 |
| InChI | InChI=1S/C19H23N3O/c1-14-7-9-15(10-8-14)19(23)22-18-12-11-17(13-20-18)21-16-5-3-2-4-6-16/h7-13,16,21H,2-6H2,1H3,(H,20,22,23) |
| InChIKey | QSVUGZFMOLDTHY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |