C20H28O3S — CID 11302507
(2S,6R)-2-[(2S,3R)-4-(benzenesulfinyl)-2-methoxy-3-methylbutyl]-6-prop-2-enyl-3,6-dihydro-2H-pyran (PubChem CID 11302507) has the molecular formula C20H28O3S and a molecular weight of 348.51 g/mol. Its IUPAC name is (2S,6R)-2-[(2S,3R)-4-(benzenesulfinyl)-2-methoxy-3-methylbutyl]-6-prop-2-enyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6R)-2-[(2S,3R)-4-(benzenesulfinyl)-2-methoxy-3-methylbutyl]-6-prop-2-enyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11302507 |
| Molecular Formula | C20H28O3S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2S,6R)-2-[(2S,3R)-4-(benzenesulfinyl)-2-methoxy-3-methylbutyl]-6-prop-2-enyl-3,6-dihydro-2H-pyran |
| SMILES | C=CC[C@@H]1C=CC[C@@H](C[C@H](OC)[C@@H](C)CS(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C20H28O3S/c1-4-9-17-10-8-11-18(23-17)14-20(22-3)16(2)15-24(21)19-12-6-5-7-13-19/h4-8,10,12-13,16-18,20H,1,9,11,14-15H2,2-3H3/t16-,17+,18-,20-,24?/m0/s1 |
| InChIKey | FWAORKURFOFBNJ-JJXHWAPYSA-N |
| XLogP | 4.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|