C20H30O5 — CID 11302548
[(E,4R)-4-[(1R,3R,4S,5R)-1,4-dimethyl-8-oxo-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate (PubChem CID 11302548) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(E,4R)-4-[(1R,3R,4S,5R)-1,4-dimethyl-8-oxo-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,4R)-4-[(1R,3R,4S,5R)-1,4-dimethyl-8-oxo-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11302548 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [(E,4R)-4-[(1R,3R,4S,5R)-1,4-dimethyl-8-oxo-2,9-dioxabicyclo[3.3.1]non-6-en-3-yl]-2-methylpent-2-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\[C@@H](C)[C@H]1O[C@@]2(C)O[C@H](C=CC2=O)[C@@H]1C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H30O5/c1-12(11-23-18(22)19(4,5)6)10-13(2)17-14(3)15-8-9-16(21)20(7,24-15)25-17/h8-10,13-15,17H,11H2,1-7H3/b12-10+/t13-,14+,15-,17-,20-/m1/s1 |
| InChIKey | QDQLGUOQXRIPQJ-XCEYDAJDSA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|