C21H26N4O4 — CID 113026085
3-(3,4-dimethoxyphenyl)-N-[5-(4-formylpiperazin-1-yl)-2-pyridinyl]propanamide (PubChem CID 113026085) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[5-(4-formylpiperazin-1-yl)-2-pyridinyl]propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[5-(4-formylpiperazin-1-yl)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 113026085 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[5-(4-formylpiperazin-1-yl)-2-pyridinyl]propanamide |
| SMILES | COc1ccc(CCC(=O)Nc2ccc(N3CCN(C=O)CC3)cn2)cc1OC |
| InChI | InChI=1S/C21H26N4O4/c1-28-18-6-3-16(13-19(18)29-2)4-8-21(27)23-20-7-5-17(14-22-20)25-11-9-24(15-26)10-12-25/h3,5-7,13-15H,4,8-12H2,1-2H3,(H,22,23,27) |
| InChIKey | ADXRFBXIOPLDMR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|