C17H13F2N3O2 — CID 113026285
3,4-difluoro-N-[5-(furan-2-ylmethylamino)-2-pyridinyl]benzamide (PubChem CID 113026285) has the molecular formula C17H13F2N3O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 3,4-difluoro-N-[5-(furan-2-ylmethylamino)-2-pyridinyl]benzamide.
| Compound Name | 3,4-difluoro-N-[5-(furan-2-ylmethylamino)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113026285 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3,4-difluoro-N-[5-(furan-2-ylmethylamino)-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(NCc2ccco2)cn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H13F2N3O2/c18-14-5-3-11(8-15(14)19)17(23)22-16-6-4-12(9-21-16)20-10-13-2-1-7-24-13/h1-9,20H,10H2,(H,21,22,23) |
| InChIKey | XNLNLPWBDCGYTD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |