C22H25N3O2S — CID 113026556
N-[5-[(2-methylphenyl)methylamino]-2-pyridinyl]-4-propan-2-ylbenzenesulfonamide (PubChem CID 113026556) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is N-[5-[(2-methylphenyl)methylamino]-2-pyridinyl]-4-propan-2-ylbenzenesulfonamide.
| Compound Name | N-[5-[(2-methylphenyl)methylamino]-2-pyridinyl]-4-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 113026556 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-[5-[(2-methylphenyl)methylamino]-2-pyridinyl]-4-propan-2-ylbenzenesulfonamide |
| SMILES | Cc1ccccc1CNc1ccc(NS(=O)(=O)c2ccc(C(C)C)cc2)nc1 |
| InChI | InChI=1S/C22H25N3O2S/c1-16(2)18-8-11-21(12-9-18)28(26,27)25-22-13-10-20(15-24-22)23-14-19-7-5-4-6-17(19)3/h4-13,15-16,23H,14H2,1-3H3,(H,24,25) |
| InChIKey | AAVANJDPTGAWTH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |