C24H18O3 — CID 11302671
(1S,2aS,8bS)-2a-benzoyl-1-phenyl-2,8b-dihydro-1H-cyclobuta[c]chromen-3-one (PubChem CID 11302671) has the molecular formula C24H18O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (1S,2aS,8bS)-2a-benzoyl-1-phenyl-2,8b-dihydro-1H-cyclobuta[c]chromen-3-one.
| Compound Name | (1S,2aS,8bS)-2a-benzoyl-1-phenyl-2,8b-dihydro-1H-cyclobuta[c]chromen-3-one |
|---|---|
| PubChem CID | 11302671 |
| Molecular Formula | C24H18O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (1S,2aS,8bS)-2a-benzoyl-1-phenyl-2,8b-dihydro-1H-cyclobuta[c]chromen-3-one |
| SMILES | O=C1Oc2ccccc2[C@@H]2[C@@H](c3ccccc3)C[C@]12C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H18O3/c25-22(17-11-5-2-6-12-17)24-15-19(16-9-3-1-4-10-16)21(24)18-13-7-8-14-20(18)27-23(24)26/h1-14,19,21H,15H2/t19-,21-,24+/m1/s1 |
| InChIKey | YBUQXRTVVSHLHZ-ZYKOEDHHSA-N |
| XLogP | 4.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|