C16H22N4O2S — CID 113027603
5-[benzyl(ethyl)amino]-2-(dimethylsulfamoylamino)pyridine (PubChem CID 113027603) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 5-[benzyl(ethyl)amino]-2-(dimethylsulfamoylamino)pyridine.
| Compound Name | 5-[benzyl(ethyl)amino]-2-(dimethylsulfamoylamino)pyridine |
|---|---|
| PubChem CID | 113027603 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 5-[benzyl(ethyl)amino]-2-(dimethylsulfamoylamino)pyridine |
| SMILES | CCN(Cc1ccccc1)c1ccc(NS(=O)(=O)N(C)C)nc1 |
| InChI | InChI=1S/C16H22N4O2S/c1-4-20(13-14-8-6-5-7-9-14)15-10-11-16(17-12-15)18-23(21,22)19(2)3/h5-12H,4,13H2,1-3H3,(H,17,18) |
| InChIKey | KYFLQJPYZMMLGL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |