C22H22FN3O3 — CID 113028190
N-[5-[2-(2-fluorophenyl)ethylamino]-2-pyridinyl]-3,4-dimethoxybenzamide (PubChem CID 113028190) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[5-[2-(2-fluorophenyl)ethylamino]-2-pyridinyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[5-[2-(2-fluorophenyl)ethylamino]-2-pyridinyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 113028190 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-[5-[2-(2-fluorophenyl)ethylamino]-2-pyridinyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(NCCc3ccccc3F)cn2)cc1OC |
| InChI | InChI=1S/C22H22FN3O3/c1-28-19-9-7-16(13-20(19)29-2)22(27)26-21-10-8-17(14-25-21)24-12-11-15-5-3-4-6-18(15)23/h3-10,13-14,24H,11-12H2,1-2H3,(H,25,26,27) |
| InChIKey | VLXILBQSQSMIOV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |