C22H24N2O3 — CID 11303019
methyl (3S,6S,7S,8aS)-3-benzyl-4-oxo-7-phenyl-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-6-carboxylate (PubChem CID 11303019) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is methyl (3S,6S,7S,8aS)-3-benzyl-4-oxo-7-phenyl-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-6-carboxylate.
| Compound Name | methyl (3S,6S,7S,8aS)-3-benzyl-4-oxo-7-phenyl-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-6-carboxylate |
|---|---|
| PubChem CID | 11303019 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | methyl (3S,6S,7S,8aS)-3-benzyl-4-oxo-7-phenyl-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2ccccc2)C[C@H]2CN[C@@H](Cc3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C22H24N2O3/c1-27-22(26)20-18(16-10-6-3-7-11-16)13-17-14-23-19(21(25)24(17)20)12-15-8-4-2-5-9-15/h2-11,17-20,23H,12-14H2,1H3/t17-,18-,19-,20-/m0/s1 |
| InChIKey | UOEAKHPFGIRWIN-MUGJNUQGSA-N |
| XLogP | 2.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |