C15H18NO2 — CID 11303039
CID 11303039 (PubChem CID 11303039) has the molecular formula C15H18NO2 and a molecular weight of 244.31 g/mol.
| Compound Name | CID 11303039 |
|---|---|
| PubChem CID | 11303039 |
| Molecular Formula | C15H18NO2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | — |
| SMILES | COc1ccc(CNC[C]2[CH][CH][CH][CH]2)cc1OC |
| InChI | InChI=1S/C15H18NO2/c1-17-14-8-7-13(9-15(14)18-2)11-16-10-12-5-3-4-6-12/h3-9,16H,10-11H2,1-2H3 |
| InChIKey | CQKQXEXNEHMZJT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |