C18H28N4O — CID 113030823
1-cyclohexyl-3-[5-(3-methylpiperidin-1-yl)-2-pyridinyl]urea (PubChem CID 113030823) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[5-(3-methylpiperidin-1-yl)-2-pyridinyl]urea.
| Compound Name | 1-cyclohexyl-3-[5-(3-methylpiperidin-1-yl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 113030823 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 1-cyclohexyl-3-[5-(3-methylpiperidin-1-yl)-2-pyridinyl]urea |
| SMILES | CC1CCCN(c2ccc(NC(=O)NC3CCCCC3)nc2)C1 |
| InChI | InChI=1S/C18H28N4O/c1-14-6-5-11-22(13-14)16-9-10-17(19-12-16)21-18(23)20-15-7-3-2-4-8-15/h9-10,12,14-15H,2-8,11,13H2,1H3,(H2,19,20,21,23) |
| InChIKey | MFBJKSSFRJVNLB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |