C18H24FN3O2S — CID 113030968
N-[5-(dipropylamino)-2-pyridinyl]-4-fluoro-3-methylbenzenesulfonamide (PubChem CID 113030968) has the molecular formula C18H24FN3O2S and a molecular weight of 365.47 g/mol. Its IUPAC name is N-[5-(dipropylamino)-2-pyridinyl]-4-fluoro-3-methylbenzenesulfonamide.
| Compound Name | N-[5-(dipropylamino)-2-pyridinyl]-4-fluoro-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113030968 |
| Molecular Formula | C18H24FN3O2S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[5-(dipropylamino)-2-pyridinyl]-4-fluoro-3-methylbenzenesulfonamide |
| SMILES | CCCN(CCC)c1ccc(NS(=O)(=O)c2ccc(F)c(C)c2)nc1 |
| InChI | InChI=1S/C18H24FN3O2S/c1-4-10-22(11-5-2)15-6-9-18(20-13-15)21-25(23,24)16-7-8-17(19)14(3)12-16/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,20,21) |
| InChIKey | LUWKTVQRSXFNQC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |