C22H22ClN3O — CID 113031036
N-[5-[2-(3-chlorophenyl)ethylamino]-2-pyridinyl]-2-(4-methylphenyl)acetamide (PubChem CID 113031036) has the molecular formula C22H22ClN3O and a molecular weight of 379.89 g/mol. Its IUPAC name is N-[5-[2-(3-chlorophenyl)ethylamino]-2-pyridinyl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[5-[2-(3-chlorophenyl)ethylamino]-2-pyridinyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 113031036 |
| Molecular Formula | C22H22ClN3O |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[5-[2-(3-chlorophenyl)ethylamino]-2-pyridinyl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2ccc(NCCc3cccc(Cl)c3)cn2)cc1 |
| InChI | InChI=1S/C22H22ClN3O/c1-16-5-7-18(8-6-16)14-22(27)26-21-10-9-20(15-25-21)24-12-11-17-3-2-4-19(23)13-17/h2-10,13,15,24H,11-12,14H2,1H3,(H,25,26,27) |
| InChIKey | QELPVVQSXFRDPL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |