About 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one
7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one (PubChem CID 11303189) has the molecular formula C20H16ClNO2S
and a molecular weight of 369.87 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one.
Molecular Properties
| Compound Name | 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one |
| PubChem CID | 11303189 |
| Molecular Formula | C20H16ClNO2S |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one |
| SMILES | CC1(c2cccs2)OCC(=O)Nc2ccc(-c3cccc(Cl)c3)cc21 |
| InChI | InChI=1S/C20H16ClNO2S/c1-20(18-6-3-9-25-18)16-11-14(13-4-2-5-15(21)10-13)7-8-17(16)22-19(23)12-24-20/h2-11H,12H2,1H3,(H,22,23) |
| InChIKey | XFVYNJHCIDTYEO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one?
The IUPAC name of 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one (CID 11303189) is 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one.
What is the SMILES notation for 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one?
The canonical SMILES for 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one is CC1(c2cccs2)OCC(=O)Nc2ccc(-c3cccc(Cl)c3)cc21.
What is the InChIKey of 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one?
The InChIKey is XFVYNJHCIDTYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClNO2S/c1-20(18-6-3-9-25-18)16-11-14(13-4-2-5-15(21)10-13)7-8-17(16)22-19(23)12-24-20/h2-11H,12H2,1H3,(H,22,23).
What are the key properties of 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one?
7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one has a molecular weight of 369.87 g/mol, XLogP of 5.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-chlorophenyl)-5-methyl-5-thiophen-2-yl-1H-4,1-benzoxazepin-2-one is sourced from PubChem (CID 11303189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).