C23H25N3O3 — CID 113032663
N-[5-(2-ethyl-6-methylanilino)-2-pyridinyl]-3,5-dimethoxybenzamide (PubChem CID 113032663) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[5-(2-ethyl-6-methylanilino)-2-pyridinyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[5-(2-ethyl-6-methylanilino)-2-pyridinyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 113032663 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[5-(2-ethyl-6-methylanilino)-2-pyridinyl]-3,5-dimethoxybenzamide |
| SMILES | CCc1cccc(C)c1Nc1ccc(NC(=O)c2cc(OC)cc(OC)c2)nc1 |
| InChI | InChI=1S/C23H25N3O3/c1-5-16-8-6-7-15(2)22(16)25-18-9-10-21(24-14-18)26-23(27)17-11-19(28-3)13-20(12-17)29-4/h6-14,25H,5H2,1-4H3,(H,24,26,27) |
| InChIKey | KYUZUIQBELHATP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |