C18H35NO5Si — CID 11303321
[(E,3S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-yl] carbamate (PubChem CID 11303321) has the molecular formula C18H35NO5Si and a molecular weight of 373.57 g/mol. Its IUPAC name is [(E,3S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-yl] carbamate.
| Compound Name | [(E,3S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-yl] carbamate |
|---|---|
| PubChem CID | 11303321 |
| Molecular Formula | C18H35NO5Si |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | [(E,3S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-1-en-3-yl] carbamate |
| SMILES | CC[C@@H](/C=C/[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C)OC(N)=O |
| InChI | InChI=1S/C18H35NO5Si/c1-9-13(22-16(19)20)10-11-14-15(24-18(5,6)23-14)12-21-25(7,8)17(2,3)4/h10-11,13-15H,9,12H2,1-8H3,(H2,19,20)/b11-10+/t13-,14-,15-/m0/s1 |
| InChIKey | ZIIJBAOXAUKLNH-ASNZMKRJSA-N |
| XLogP | 3.96 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|