C17H15ClF3N3O2 — CID 113036581
N-[5-[4-chloro-2-(trifluoromethyl)anilino]-2-pyridinyl]oxolane-2-carboxamide (PubChem CID 113036581) has the molecular formula C17H15ClF3N3O2 and a molecular weight of 385.77 g/mol. Its IUPAC name is N-[5-[4-chloro-2-(trifluoromethyl)anilino]-2-pyridinyl]oxolane-2-carboxamide.
| Compound Name | N-[5-[4-chloro-2-(trifluoromethyl)anilino]-2-pyridinyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 113036581 |
| Molecular Formula | C17H15ClF3N3O2 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N-[5-[4-chloro-2-(trifluoromethyl)anilino]-2-pyridinyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(Cl)cc2C(F)(F)F)cn1)C1CCCO1 |
| InChI | InChI=1S/C17H15ClF3N3O2/c18-10-3-5-13(12(8-10)17(19,20)21)23-11-4-6-15(22-9-11)24-16(25)14-2-1-7-26-14/h3-6,8-9,14,23H,1-2,7H2,(H,22,24,25) |
| InChIKey | ZFGHEBRBSLPROY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |