C21H18N4O — CID 113037072
N-[5-(2-cyanoanilino)-2-pyridinyl]-3-phenylpropanamide (PubChem CID 113037072) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[5-(2-cyanoanilino)-2-pyridinyl]-3-phenylpropanamide.
| Compound Name | N-[5-(2-cyanoanilino)-2-pyridinyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 113037072 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-[5-(2-cyanoanilino)-2-pyridinyl]-3-phenylpropanamide |
| SMILES | N#Cc1ccccc1Nc1ccc(NC(=O)CCc2ccccc2)nc1 |
| InChI | InChI=1S/C21H18N4O/c22-14-17-8-4-5-9-19(17)24-18-11-12-20(23-15-18)25-21(26)13-10-16-6-2-1-3-7-16/h1-9,11-12,15,24H,10,13H2,(H,23,25,26) |
| InChIKey | NWDRBUPCJBOAEK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |