C19H34O6Si — CID 11303737
(2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3,6-trimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one (PubChem CID 11303737) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is (2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3,6-trimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one.
| Compound Name | (2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3,6-trimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one |
|---|---|
| PubChem CID | 11303737 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3,6-trimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one |
| SMILES | CO[C@]1(C)O[C@H]2[C@H](O[C@@]1(C)OC)C(=O)C(C)=C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O6Si/c1-12-11-13(25-26(9,10)17(2,3)4)15-16(14(12)20)24-19(6,22-8)18(5,21-7)23-15/h11,13,15-16H,1-10H3/t13-,15-,16-,18-,19-/m1/s1 |
| InChIKey | QKSBJLLXUCQKDN-IGIMTQTPSA-N |
| XLogP | 3.41 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|