C19H14F3N3O2 — CID 113037429
3-methoxy-N-[5-(2,3,4-trifluoroanilino)-2-pyridinyl]benzamide (PubChem CID 113037429) has the molecular formula C19H14F3N3O2 and a molecular weight of 373.33 g/mol. Its IUPAC name is 3-methoxy-N-[5-(2,3,4-trifluoroanilino)-2-pyridinyl]benzamide.
| Compound Name | 3-methoxy-N-[5-(2,3,4-trifluoroanilino)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113037429 |
| Molecular Formula | C19H14F3N3O2 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 3-methoxy-N-[5-(2,3,4-trifluoroanilino)-2-pyridinyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(Nc3ccc(F)c(F)c3F)cn2)c1 |
| InChI | InChI=1S/C19H14F3N3O2/c1-27-13-4-2-3-11(9-13)19(26)25-16-8-5-12(10-23-16)24-15-7-6-14(20)17(21)18(15)22/h2-10,24H,1H3,(H,23,25,26) |
| InChIKey | CHIIQWKWAAQMPA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|