C15H18N4O2S — CID 113038129
N-[6-(cyclopropylamino)pyridazin-3-yl]-2,5-dimethylbenzenesulfonamide (PubChem CID 113038129) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[6-(cyclopropylamino)pyridazin-3-yl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[6-(cyclopropylamino)pyridazin-3-yl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113038129 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[6-(cyclopropylamino)pyridazin-3-yl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc(NC3CC3)nn2)c1 |
| InChI | InChI=1S/C15H18N4O2S/c1-10-3-4-11(2)13(9-10)22(20,21)19-15-8-7-14(17-18-15)16-12-5-6-12/h3-4,7-9,12H,5-6H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | GHVIUABBGBOVHU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |