C23H21NO5 — CID 11303884
(3-methoxycarbonylphenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate (PubChem CID 11303884) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is (3-methoxycarbonylphenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate.
| Compound Name | (3-methoxycarbonylphenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate |
|---|---|
| PubChem CID | 11303884 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (3-methoxycarbonylphenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate |
| SMILES | COC(=O)c1cccc(OC(=O)c2ccc3c(c2)CCC2=C(C)C(=O)CCN23)c1 |
| InChI | InChI=1S/C23H21NO5/c1-14-19-8-6-15-12-17(7-9-20(15)24(19)11-10-21(14)25)23(27)29-18-5-3-4-16(13-18)22(26)28-2/h3-5,7,9,12-13H,6,8,10-11H2,1-2H3 |
| InChIKey | KDPMZKZPARTUIW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|