C16H16F2N4O2 — CID 113039818
3,4-difluoro-N-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]benzamide (PubChem CID 113039818) has the molecular formula C16H16F2N4O2 and a molecular weight of 334.33 g/mol. Its IUPAC name is 3,4-difluoro-N-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]benzamide.
| Compound Name | 3,4-difluoro-N-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]benzamide |
|---|---|
| PubChem CID | 113039818 |
| Molecular Formula | C16H16F2N4O2 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3,4-difluoro-N-[6-(oxolan-2-ylmethylamino)pyridazin-3-yl]benzamide |
| SMILES | O=C(Nc1ccc(NCC2CCCO2)nn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H16F2N4O2/c17-12-4-3-10(8-13(12)18)16(23)20-15-6-5-14(21-22-15)19-9-11-2-1-7-24-11/h3-6,8,11H,1-2,7,9H2,(H,19,21)(H,20,22,23) |
| InChIKey | XHCRSVDRQJQNGO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |