C19H25N5O3 — CID 113040037
2-(4-methoxyphenyl)-N-[6-(2-morpholin-4-ylethylamino)pyridazin-3-yl]acetamide (PubChem CID 113040037) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[6-(2-morpholin-4-ylethylamino)pyridazin-3-yl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[6-(2-morpholin-4-ylethylamino)pyridazin-3-yl]acetamide |
|---|---|
| PubChem CID | 113040037 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[6-(2-morpholin-4-ylethylamino)pyridazin-3-yl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(NCCN3CCOCC3)nn2)cc1 |
| InChI | InChI=1S/C19H25N5O3/c1-26-16-4-2-15(3-5-16)14-19(25)21-18-7-6-17(22-23-18)20-8-9-24-10-12-27-13-11-24/h2-7H,8-14H2,1H3,(H,20,22)(H,21,23,25) |
| InChIKey | ULMWLEPEJHSNHI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |