C16H18N4O2 — CID 113041743
N-[6-[(4-methoxyphenyl)methylamino]pyridazin-3-yl]cyclopropanecarboxamide (PubChem CID 113041743) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[6-[(4-methoxyphenyl)methylamino]pyridazin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[6-[(4-methoxyphenyl)methylamino]pyridazin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 113041743 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[6-[(4-methoxyphenyl)methylamino]pyridazin-3-yl]cyclopropanecarboxamide |
| SMILES | COc1ccc(CNc2ccc(NC(=O)C3CC3)nn2)cc1 |
| InChI | InChI=1S/C16H18N4O2/c1-22-13-6-2-11(3-7-13)10-17-14-8-9-15(20-19-14)18-16(21)12-4-5-12/h2-3,6-9,12H,4-5,10H2,1H3,(H,17,19)(H,18,20,21) |
| InChIKey | WZLDIGGBDZTONF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |