C21H27F2NO5 — CID 11304451
7-[(4R)-4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]heptanoic acid (PubChem CID 11304451) has the molecular formula C21H27F2NO5 and a molecular weight of 411.45 g/mol. Its IUPAC name is 7-[(4R)-4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]heptanoic acid.
| Compound Name | 7-[(4R)-4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]heptanoic acid |
|---|---|
| PubChem CID | 11304451 |
| Molecular Formula | C21H27F2NO5 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 7-[(4R)-4-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)OCC[C@@H]1/C=C/C(O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C21H27F2NO5/c22-21(23,16-8-4-3-5-9-16)18(25)12-11-17-13-15-29-20(28)24(17)14-7-2-1-6-10-19(26)27/h3-5,8-9,11-12,17-18,25H,1-2,6-7,10,13-15H2,(H,26,27)/b12-11+/t17-,18?/m0/s1 |
| InChIKey | VGHAJKLXZTVQSS-ZOVTXPBASA-N |
| XLogP | 3.94 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|