C18H21N5O7 — CID 11304681
(2R,3R,4R,5R)-2-(hydroxymethyl)-5-[[5-[(2-nitro-5-prop-2-ynoxyphenoxy)methyl]triazol-1-yl]methyl]pyrrolidine-3,4-diol (PubChem CID 11304681) has the molecular formula C18H21N5O7 and a molecular weight of 419.39 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(hydroxymethyl)-5-[[5-[(2-nitro-5-prop-2-ynoxyphenoxy)methyl]triazol-1-yl]methyl]pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(hydroxymethyl)-5-[[5-[(2-nitro-5-prop-2-ynoxyphenoxy)methyl]triazol-1-yl]methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 11304681 |
| Molecular Formula | C18H21N5O7 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2R,3R,4R,5R)-2-(hydroxymethyl)-5-[[5-[(2-nitro-5-prop-2-ynoxyphenoxy)methyl]triazol-1-yl]methyl]pyrrolidine-3,4-diol |
| SMILES | C#CCOc1ccc([N+](=O)[O-])c(OCc2cnnn2C[C@H]2N[C@H](CO)[C@@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C18H21N5O7/c1-2-5-29-12-3-4-15(23(27)28)16(6-12)30-10-11-7-19-21-22(11)8-13-17(25)18(26)14(9-24)20-13/h1,3-4,6-7,13-14,17-18,20,24-26H,5,8-10H2/t13-,14-,17-,18-/m1/s1 |
| InChIKey | ARDUTXZJPIUNKO-DTTOXWODSA-N |
| XLogP | -1.17 |
| TPSA | 165.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|