C27H24FNO3 — CID 11304952
(5Z)-5-[(2-fluorophenyl)methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol (PubChem CID 11304952) has the molecular formula C27H24FNO3 and a molecular weight of 429.49 g/mol. Its IUPAC name is (5Z)-5-[(2-fluorophenyl)methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol.
| Compound Name | (5Z)-5-[(2-fluorophenyl)methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol |
|---|---|
| PubChem CID | 11304952 |
| Molecular Formula | C27H24FNO3 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (5Z)-5-[(2-fluorophenyl)methylidene]-10-methoxy-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-9-ol |
| SMILES | COc1c(O)ccc2c1-c1ccc3c(c1/C(=C/c1ccccc1F)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C27H24FNO3/c1-15-14-27(2,3)29-19-10-9-17-24(23(15)19)22(13-16-7-5-6-8-18(16)28)32-21-12-11-20(30)26(31-4)25(17)21/h5-14,29-30H,1-4H3/b22-13- |
| InChIKey | MPVGXDFFAWVSJS-XKZIYDEJSA-N |
| XLogP | 6.70 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|