C23H31N3OS2 — CID 11304963
5-(dithiolan-3-yl)-N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]pentanamide (PubChem CID 11304963) has the molecular formula C23H31N3OS2 and a molecular weight of 429.66 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]pentanamide |
|---|---|
| PubChem CID | 11304963 |
| Molecular Formula | C23H31N3OS2 |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]pentanamide |
| SMILES | O=C(CCCCC1CCSS1)NCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C23H31N3OS2/c27-22(12-6-1-7-17-13-16-28-29-17)24-14-15-25-23-18-8-2-4-10-20(18)26-21-11-5-3-9-19(21)23/h2,4,8,10,17H,1,3,5-7,9,11-16H2,(H,24,27)(H,25,26) |
| InChIKey | AJUUAUZWBQPTFD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|