C18H16BrN5O — CID 113050162
1-[6-(4-bromo-2-methylanilino)pyridazin-3-yl]-3-phenylurea (PubChem CID 113050162) has the molecular formula C18H16BrN5O and a molecular weight of 398.26 g/mol. Its IUPAC name is 1-[6-(4-bromo-2-methylanilino)pyridazin-3-yl]-3-phenylurea.
| Compound Name | 1-[6-(4-bromo-2-methylanilino)pyridazin-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 113050162 |
| Molecular Formula | C18H16BrN5O |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 1-[6-(4-bromo-2-methylanilino)pyridazin-3-yl]-3-phenylurea |
| SMILES | Cc1cc(Br)ccc1Nc1ccc(NC(=O)Nc2ccccc2)nn1 |
| InChI | InChI=1S/C18H16BrN5O/c1-12-11-13(19)7-8-15(12)21-16-9-10-17(24-23-16)22-18(25)20-14-5-3-2-4-6-14/h2-11H,1H3,(H,21,23)(H2,20,22,24,25) |
| InChIKey | NDWZJPFYXSEJAC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |