About 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole
3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole (PubChem CID 11305129) has the molecular formula C25H23Cl2N3
and a molecular weight of 436.39 g/mol. Its IUPAC name is 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole.
Molecular Properties
| Compound Name | 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole |
| PubChem CID | 11305129 |
| Molecular Formula | C25H23Cl2N3 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole |
| SMILES | Clc1cccc(Cl)c1C1CCN(Cc2c(-c3ccccn3)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C25H23Cl2N3/c26-20-7-5-8-21(27)24(20)17-11-14-30(15-12-17)16-19-18-6-1-2-9-22(18)29-25(19)23-10-3-4-13-28-23/h1-10,13,17,29H,11-12,14-16H2 |
| InChIKey | ZUXTUBUTJWRMEF-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole?
The IUPAC name of 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole (CID 11305129) is 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole.
What is the SMILES notation for 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole?
The canonical SMILES for 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole is Clc1cccc(Cl)c1C1CCN(Cc2c(-c3ccccn3)[nH]c3ccccc23)CC1.
What is the InChIKey of 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole?
The InChIKey is ZUXTUBUTJWRMEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23Cl2N3/c26-20-7-5-8-21(27)24(20)17-11-14-30(15-12-17)16-19-18-6-1-2-9-22(18)29-25(19)23-10-3-4-13-28-23/h1-10,13,17,29H,11-12,14-16H2.
What are the key properties of 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole?
3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole has a molecular weight of 436.39 g/mol, XLogP of 6.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2,6-dichlorophenyl)piperidin-1-yl]methyl]-2-pyridin-2-yl-1H-indole is sourced from PubChem (CID 11305129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).